C29H31F3N4O4S — CID 70654532
N-[4-[(1R,3R,4S,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 70654532) has the molecular formula C29H31F3N4O4S and a molecular weight of 588.65 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70654532 |
| Molecular Formula | C29H31F3N4O4S |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[4-(1,1-dioxothian-4-yl)-2,6-difluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4CCS(=O)(=O)CC4)cc3F)n2)C[C@@H](N)[C@H]1O |
| InChI | InChI=1S/C29H31F3N4O4S/c1-15-10-18(13-23(33)28(15)37)19-4-7-34-14-25(19)36-29(38)24-3-2-20(30)27(35-24)26-21(31)11-17(12-22(26)32)16-5-8-41(39,40)9-6-16/h2-4,7,11-12,14-16,18,23,28,37H,5-6,8-10,13,33H2,1H3,(H,36,38)/t15-,18+,23+,28-/m0/s1 |
| InChIKey | OTFLKADXCALFED-QPOIIHEISA-N |
| XLogP | 4.31 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |