C29H31F3N4O4 — CID 70655600
N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 70655600) has the molecular formula C29H31F3N4O4 and a molecular weight of 556.59 g/mol. Its IUPAC name is N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 70655600 |
| Molecular Formula | C29H31F3N4O4 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-3-yloxy)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(OC4CCCOC4)cc3F)n2)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C29H31F3N4O4/c1-15-9-16(10-23(33)28(15)37)19-6-7-34-13-25(19)36-29(38)24-5-4-20(30)27(35-24)26-21(31)11-18(12-22(26)32)40-17-3-2-8-39-14-17/h4-7,11-13,15-17,23,28,37H,2-3,8-10,14,33H2,1H3,(H,36,38)/t15-,16+,17?,23+,28+/m0/s1 |
| InChIKey | QSLPKLCRZDMBQQ-NPIJUIEZSA-N |
| XLogP | 4.57 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |