C30H32F3N5O4 — CID 118063010
methyl N-amino-N-[(2S,4R)-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-2-methylcyclohexyl]carbamate (PubChem CID 118063010) has the molecular formula C30H32F3N5O4 and a molecular weight of 583.61 g/mol. Its IUPAC name is methyl N-amino-N-[(2S,4R)-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-2-methylcyclohexyl]carbamate.
| Compound Name | methyl N-amino-N-[(2S,4R)-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-2-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 118063010 |
| Molecular Formula | C30H32F3N5O4 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | methyl N-amino-N-[(2S,4R)-4-[3-[[6-[2,6-difluoro-4-(1-hydroxycyclobutyl)phenyl]-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-2-methylcyclohexyl]carbamate |
| SMILES | COC(=O)N(N)C1CC[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(C4(O)CCC4)cc3F)n2)C[C@@H]1C |
| InChI | InChI=1S/C30H32F3N5O4/c1-16-12-17(4-7-25(16)38(34)29(40)42-2)19-8-11-35-15-24(19)37-28(39)23-6-5-20(31)27(36-23)26-21(32)13-18(14-22(26)33)30(41)9-3-10-30/h5-6,8,11,13-17,25,41H,3-4,7,9-10,12,34H2,1-2H3,(H,37,39)/t16-,17+,25?/m0/s1 |
| InChIKey | VAVSTMWOZSFFHK-WAPIFTKLSA-N |
| XLogP | 5.40 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|