C21H31N5O4 — CID 175904009
tert-butyl N-[(3R,4R)-1-(2-tert-butyl-5-nitroindazol-4-yl)-4-methylpyrrolidin-3-yl]carbamate (PubChem CID 175904009) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-(2-tert-butyl-5-nitroindazol-4-yl)-4-methylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-(2-tert-butyl-5-nitroindazol-4-yl)-4-methylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175904009 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-(2-tert-butyl-5-nitroindazol-4-yl)-4-methylpyrrolidin-3-yl]carbamate |
| SMILES | C[C@@H]1CN(c2c([N+](=O)[O-])ccc3nn(C(C)(C)C)cc23)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N5O4/c1-13-10-24(12-16(13)22-19(27)30-21(5,6)7)18-14-11-25(20(2,3)4)23-15(14)8-9-17(18)26(28)29/h8-9,11,13,16H,10,12H2,1-7H3,(H,22,27)/t13-,16+/m1/s1 |
| InChIKey | UKEBCTHNVAUDJV-CJNGLKHVSA-N |
| XLogP | 4.05 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|