C27H35ClN4O7 — CID 20792079
ethyl 8-chloro-1-cyclopropyl-7-[(3S,4R,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-6-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 20792079) has the molecular formula C27H35ClN4O7 and a molecular weight of 563.05 g/mol. Its IUPAC name is ethyl 8-chloro-1-cyclopropyl-7-[(3S,4R,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-6-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-chloro-1-cyclopropyl-7-[(3S,4R,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-6-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 20792079 |
| Molecular Formula | C27H35ClN4O7 |
| Molecular Weight | 563.05 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | ethyl 8-chloro-1-cyclopropyl-7-[(3S,4R,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-6-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(Cl)c(N3C[C@@H](C)C(C)[C@H](NC(=O)OC(C)(C)C)C3)c([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C27H35ClN4O7/c1-7-38-25(34)18-12-31(16-8-9-16)22-17(24(18)33)10-20(32(36)37)23(21(22)28)30-11-14(2)15(3)19(13-30)29-26(35)39-27(4,5)6/h10,12,14-16,19H,7-9,11,13H2,1-6H3,(H,29,35)/t14-,15?,19-/m1/s1 |
| InChIKey | UBUZRNGTMCOUJJ-NQUBZZJWSA-N |
| XLogP | 5.06 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.05 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|