C19H34N2O2Si — CID 70656065
(1S,2S,4S,6R)-4-(3-amino-4-pyridinyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohexan-1-ol (PubChem CID 70656065) has the molecular formula C19H34N2O2Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1S,2S,4S,6R)-4-(3-amino-4-pyridinyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohexan-1-ol.
| Compound Name | (1S,2S,4S,6R)-4-(3-amino-4-pyridinyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 70656065 |
| Molecular Formula | C19H34N2O2Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (1S,2S,4S,6R)-4-(3-amino-4-pyridinyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohexan-1-ol |
| SMILES | C[C@@H]1C[C@H](c2ccncc2N)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)O |
| InChI | InChI=1S/C19H34N2O2Si/c1-13-10-14(15-8-9-21-12-16(15)20)11-17(19(13,5)22)23-24(6,7)18(2,3)4/h8-9,12-14,17,22H,10-11,20H2,1-7H3/t13-,14+,17+,19+/m1/s1 |
| InChIKey | ACUWYNITPBXWJY-BDFQZXNOSA-N |
| XLogP | 4.32 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|