C19H25N3O3 — CID 141248060
tert-butyl 5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-1,3,3a,4,5,6-hexahydroindole-3-carboxylate (PubChem CID 141248060) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is tert-butyl 5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-1,3,3a,4,5,6-hexahydroindole-3-carboxylate.
| Compound Name | tert-butyl 5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-1,3,3a,4,5,6-hexahydroindole-3-carboxylate |
|---|---|
| PubChem CID | 141248060 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | tert-butyl 5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-1,3,3a,4,5,6-hexahydroindole-3-carboxylate |
| SMILES | CC1=C2NC(=O)C(C(=O)OC(C)(C)C)C2CC(c2ccncc2N)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-10-7-11(12-5-6-21-9-14(12)20)8-13-15(17(23)22-16(10)13)18(24)25-19(2,3)4/h5-6,9,11,13,15H,7-8,20H2,1-4H3,(H,22,23) |
| InChIKey | ITXZRFXQSIOCJN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|