C18H26N4O3 — CID 141248055
tert-butyl (3aR,7R,7aS)-5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine-3-carboxylate (PubChem CID 141248055) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl (3aR,7R,7aS)-5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine-3-carboxylate.
| Compound Name | tert-butyl (3aR,7R,7aS)-5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 141248055 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | tert-butyl (3aR,7R,7aS)-5-(3-amino-4-pyridinyl)-7-methyl-2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridine-3-carboxylate |
| SMILES | C[C@@H]1CN(c2ccncc2N)C[C@H]2C(C(=O)OC(C)(C)C)C(=O)N[C@@H]12 |
| InChI | InChI=1S/C18H26N4O3/c1-10-8-22(13-5-6-20-7-12(13)19)9-11-14(16(23)21-15(10)11)17(24)25-18(2,3)4/h5-7,10-11,14-15H,8-9,19H2,1-4H3,(H,21,23)/t10-,11+,14?,15+/m1/s1 |
| InChIKey | MIPHRMSWUKLVKH-KAPXJORDSA-N |
| XLogP | 1.19 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|