C18H30N2O5Si- — CID 163725713
CID 163725713 (PubChem CID 163725713) has the molecular formula C18H30N2O5Si- and a molecular weight of 382.53 g/mol.
| Compound Name | CID 163725713 |
|---|---|
| PubChem CID | 163725713 |
| Molecular Formula | C18H30N2O5Si- |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | — |
| SMILES | CC1(C)O[C@@H](c2ccncc2[N+](=O)[O-])C[C@H](O[Si-](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C18H30N2O5Si/c1-17(2,3)26(6,7)25-15-10-14(24-18(4,5)16(15)21)12-8-9-19-11-13(12)20(22)23/h8-9,11,14-16,21H,10H2,1-7H3/q-1/t14-,15+,16+/m1/s1 |
| InChIKey | NDEXGANKSADTKO-PMPSAXMXSA-N |
| XLogP | 3.98 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|