About CID 67130804
CID 67130804 (PubChem CID 67130804) has the molecular formula C24H38N2O6Si4
and a molecular weight of 562.92 g/mol.
Molecular Properties
| Compound Name | CID 67130804 |
| PubChem CID | 67130804 |
| Molecular Formula | C24H38N2O6Si4 |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | — |
| SMILES | C[Si]OC(O[Si]C)C(C)(C)[C@H]1[C@H](C(C)(C)C(O[Si]C)O[Si]C)C=C(c2ccncc2[N+](=O)[O-])C[C@@H]1C |
| InChI | InChI=1S/C24H38N2O6Si4/c1-15-12-16(17-10-11-25-14-19(17)26(27)28)13-18(23(2,3)21(29-33-6)30-34-7)20(15)24(4,5)22(31-35-8)32-36-9/h10-11,13-15,18,20-22H,12H2,1-9H3/t15-,18+,20+/m0/s1 |
| InChIKey | IREHNGVBWNGOKX-QKYXUNIQSA-N |
| XLogP | 5.09 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 67130804 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67130804?
The IUPAC name of CID 67130804 (CID 67130804) is not available.
What is the SMILES notation for CID 67130804?
The canonical SMILES for CID 67130804 is C[Si]OC(O[Si]C)C(C)(C)[C@H]1[C@H](C(C)(C)C(O[Si]C)O[Si]C)C=C(c2ccncc2[N+](=O)[O-])C[C@@H]1C.
What is the InChIKey of CID 67130804?
The InChIKey is IREHNGVBWNGOKX-QKYXUNIQSA-N. The full InChI is InChI=1S/C24H38N2O6Si4/c1-15-12-16(17-10-11-25-14-19(17)26(27)28)13-18(23(2,3)21(29-33-6)30-34-7)20(15)24(4,5)22(31-35-8)32-36-9/h10-11,13-15,18,20-22H,12H2,1-9H3/t15-,18+,20+/m0/s1.
What are the key properties of CID 67130804?
CID 67130804 has a molecular weight of 562.92 g/mol, XLogP of 5.09, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67130804 is sourced from PubChem (CID 67130804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).