C24H38N2O6Si4 — CID 67130804
CID 67130804 (PubChem CID 67130804) has the molecular formula C24H38N2O6Si4 and a molecular weight of 562.92 g/mol.
| Compound Name | CID 67130804 |
|---|---|
| PubChem CID | 67130804 |
| Molecular Formula | C24H38N2O6Si4 |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | — |
| SMILES | C[Si]OC(O[Si]C)C(C)(C)[C@H]1[C@H](C(C)(C)C(O[Si]C)O[Si]C)C=C(c2ccncc2[N+](=O)[O-])C[C@@H]1C |
| InChI | InChI=1S/C24H38N2O6Si4/c1-15-12-16(17-10-11-25-14-19(17)26(27)28)13-18(23(2,3)21(29-33-6)30-34-7)20(15)24(4,5)22(31-35-8)32-36-9/h10-11,13-15,18,20-22H,12H2,1-9H3/t15-,18+,20+/m0/s1 |
| InChIKey | IREHNGVBWNGOKX-QKYXUNIQSA-N |
| XLogP | 5.09 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|