C30H54N2O6Si2 — CID 123372675
[(2R,3R)-2-(methoxymethyl)-6-(3-nitro-4-pyridinyl)-3-tri(propan-2-yl)silyloxy-3,6-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 123372675) has the molecular formula C30H54N2O6Si2 and a molecular weight of 594.94 g/mol. Its IUPAC name is [(2R,3R)-2-(methoxymethyl)-6-(3-nitro-4-pyridinyl)-3-tri(propan-2-yl)silyloxy-3,6-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R)-2-(methoxymethyl)-6-(3-nitro-4-pyridinyl)-3-tri(propan-2-yl)silyloxy-3,6-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 123372675 |
| Molecular Formula | C30H54N2O6Si2 |
| Molecular Weight | 594.94 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | [(2R,3R)-2-(methoxymethyl)-6-(3-nitro-4-pyridinyl)-3-tri(propan-2-yl)silyloxy-3,6-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | COC[C@H]1OC(c2ccncc2[N+](=O)[O-])C=C(O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H54N2O6Si2/c1-19(2)39(20(3)4,21(5)6)37-28-16-27(25-14-15-31-17-26(25)32(33)34)36-29(18-35-13)30(28)38-40(22(7)8,23(9)10)24(11)12/h14-17,19-24,27,29-30H,18H2,1-13H3/t27?,29-,30+/m1/s1 |
| InChIKey | FMSIYRLFPRWXHK-LANVVXPSSA-N |
| XLogP | 8.71 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.94 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|