C24H24O8 — CID 10765558
[(7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxol-7-yl]methyl acetate (PubChem CID 10765558) has the molecular formula C24H24O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxol-7-yl]methyl acetate.
| Compound Name | [(7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxol-7-yl]methyl acetate |
|---|---|
| PubChem CID | 10765558 |
| Molecular Formula | C24H24O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | [(7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxol-7-yl]methyl acetate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C=C(C=O)[C@H]2COC(C)=O)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C24H24O8/c1-13(26)30-11-18-16(10-25)5-14-6-19-20(32-12-31-19)9-17(14)23(18)15-7-21(27-2)24(29-4)22(8-15)28-3/h5-10,18,23H,11-12H2,1-4H3/t18-,23-/m1/s1 |
| InChIKey | ZDKMUCVTCCMDEQ-WZONZLPQSA-N |
| XLogP | 3.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|