C25H25BrO8 — CID 45484270
3-bromopropyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate (PubChem CID 45484270) has the molecular formula C25H25BrO8 and a molecular weight of 533.37 g/mol. Its IUPAC name is 3-bromopropyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate.
| Compound Name | 3-bromopropyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate |
|---|---|
| PubChem CID | 45484270 |
| Molecular Formula | C25H25BrO8 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 3-bromopropyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C=C(C=O)[C@H]2C(=O)OCCCBr)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C25H25BrO8/c1-29-20-9-15(10-21(30-2)24(20)31-3)22-17-11-19-18(33-13-34-19)8-14(17)7-16(12-27)23(22)25(28)32-6-4-5-26/h7-12,22-23H,4-6,13H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | SPAWKYXSGSQPQZ-DHIUTWEWSA-N |
| XLogP | 4.11 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|