C17H21NO7 — CID 70883333
[(1S,2R,4S,5R)-2-(6-carbamoyl-1,3-benzodioxol-5-yl)-4,5-dihydroxycyclohexyl]methyl acetate (PubChem CID 70883333) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-2-(6-carbamoyl-1,3-benzodioxol-5-yl)-4,5-dihydroxycyclohexyl]methyl acetate.
| Compound Name | [(1S,2R,4S,5R)-2-(6-carbamoyl-1,3-benzodioxol-5-yl)-4,5-dihydroxycyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 70883333 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [(1S,2R,4S,5R)-2-(6-carbamoyl-1,3-benzodioxol-5-yl)-4,5-dihydroxycyclohexyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](O)[C@@H](O)C[C@H]1c1cc2c(cc1C(N)=O)OCO2 |
| InChI | InChI=1S/C17H21NO7/c1-8(19)23-6-9-2-13(20)14(21)3-10(9)11-4-15-16(25-7-24-15)5-12(11)17(18)22/h4-5,9-10,13-14,20-21H,2-3,6-7H2,1H3,(H2,18,22)/t9-,10-,13-,14+/m1/s1 |
| InChIKey | JQUDMCBMHUMFOH-MHWZDGSBSA-N |
| XLogP | 0.29 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |