C17H19NO5 — CID 163016971
6-(5-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-1,3-benzodioxole-5-carboxylic acid (PubChem CID 163016971) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 6-(5-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 6-(5-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 163016971 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 6-(5-hydroxy-1-methyl-2,3,5,6,7,7a-hexahydroindol-7-yl)-1,3-benzodioxole-5-carboxylic acid |
| SMILES | CN1CCC2=CC(O)CC(c3cc4c(cc3C(=O)O)OCO4)C21 |
| InChI | InChI=1S/C17H19NO5/c1-18-3-2-9-4-10(19)5-12(16(9)18)11-6-14-15(23-8-22-14)7-13(11)17(20)21/h4,6-7,10,12,16,19H,2-3,5,8H2,1H3,(H,20,21) |
| InChIKey | AOQKBSQBUASZKT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|