C14H17NO6 — CID 91117664
6-(2,4,5-trihydroxycyclohexyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 91117664) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 6-(2,4,5-trihydroxycyclohexyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-(2,4,5-trihydroxycyclohexyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 91117664 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 6-(2,4,5-trihydroxycyclohexyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | NC(=O)c1cc2c(cc1C1CC(O)C(O)CC1O)OCO2 |
| InChI | InChI=1S/C14H17NO6/c15-14(19)8-3-13-12(20-5-21-13)2-6(8)7-1-10(17)11(18)4-9(7)16/h2-3,7,9-11,16-18H,1,4-5H2,(H2,15,19) |
| InChIKey | HINKMCZVQQLRGZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |