C13H16N2O4 — CID 103542769
(6-amino-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 103542769) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (6-amino-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | (6-amino-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 103542769 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (6-amino-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | Nc1cc2c(cc1C(=O)N1CCC(O)CC1)OCO2 |
| InChI | InChI=1S/C13H16N2O4/c14-10-6-12-11(18-7-19-12)5-9(10)13(17)15-3-1-8(16)2-4-15/h5-6,8,16H,1-4,7,14H2 |
| InChIKey | AZUWUDJMFIKKFR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|