C13H15N3O4 — CID 103542807
1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 103542807) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103542807 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)c1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C13H15N3O4/c14-8-5-11-10(19-6-20-11)4-7(8)13(18)16-3-1-2-9(16)12(15)17/h4-5,9H,1-3,6,14H2,(H2,15,17) |
| InChIKey | RTWYWEZYEQITRQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|