C15H20N2O3 — CID 103543065
(6-amino-1,3-benzodioxol-5-yl)-(2,3-dimethylpiperidin-1-yl)methanone (PubChem CID 103543065) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (6-amino-1,3-benzodioxol-5-yl)-(2,3-dimethylpiperidin-1-yl)methanone.
| Compound Name | (6-amino-1,3-benzodioxol-5-yl)-(2,3-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 103543065 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (6-amino-1,3-benzodioxol-5-yl)-(2,3-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2cc3c(cc2N)OCO3)C1C |
| InChI | InChI=1S/C15H20N2O3/c1-9-4-3-5-17(10(9)2)15(18)11-6-13-14(7-12(11)16)20-8-19-13/h6-7,9-10H,3-5,8,16H2,1-2H3 |
| InChIKey | ILLCCFBCPCAACY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|