C14H16N2O5 — CID 103543283
methyl 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-3-carboxylate (PubChem CID 103543283) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 103543283 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 1-(6-amino-1,3-benzodioxole-5-carbonyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2cc3c(cc2N)OCO3)C1 |
| InChI | InChI=1S/C14H16N2O5/c1-19-14(18)8-2-3-16(6-8)13(17)9-4-11-12(5-10(9)15)21-7-20-11/h4-5,8H,2-3,6-7,15H2,1H3 |
| InChIKey | OVPHVZJWAAPKTA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|