C16H22N2O3 — CID 103543276
(6-amino-1,3-benzodioxol-5-yl)-(3,3-diethylpyrrolidin-1-yl)methanone (PubChem CID 103543276) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (6-amino-1,3-benzodioxol-5-yl)-(3,3-diethylpyrrolidin-1-yl)methanone.
| Compound Name | (6-amino-1,3-benzodioxol-5-yl)-(3,3-diethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103543276 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (6-amino-1,3-benzodioxol-5-yl)-(3,3-diethylpyrrolidin-1-yl)methanone |
| SMILES | CCC1(CC)CCN(C(=O)c2cc3c(cc2N)OCO3)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-16(4-2)5-6-18(9-16)15(19)11-7-13-14(8-12(11)17)21-10-20-13/h7-8H,3-6,9-10,17H2,1-2H3 |
| InChIKey | ZHMBWMWRCCJSDN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|