C21H23NO3 — CID 175560279
N-[2-[2-(1,3-benzodioxol-5-yl)-3,3-dimethylcyclobutyl]phenyl]acetamide (PubChem CID 175560279) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[2-[2-(1,3-benzodioxol-5-yl)-3,3-dimethylcyclobutyl]phenyl]acetamide.
| Compound Name | N-[2-[2-(1,3-benzodioxol-5-yl)-3,3-dimethylcyclobutyl]phenyl]acetamide |
|---|---|
| PubChem CID | 175560279 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[2-[2-(1,3-benzodioxol-5-yl)-3,3-dimethylcyclobutyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1C1CC(C)(C)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23NO3/c1-13(23)22-17-7-5-4-6-15(17)16-11-21(2,3)20(16)14-8-9-18-19(10-14)25-12-24-18/h4-10,16,20H,11-12H2,1-3H3,(H,22,23) |
| InChIKey | RLOHDHUWNJAMRU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |