C13H15N3O4 — CID 599813
2-(1,3-benzodioxol-5-yl)-4,5-dinitrosocyclohexan-1-amine (PubChem CID 599813) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4,5-dinitrosocyclohexan-1-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4,5-dinitrosocyclohexan-1-amine |
|---|---|
| PubChem CID | 599813 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4,5-dinitrosocyclohexan-1-amine |
| SMILES | NC1CC(N=O)C(N=O)CC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15N3O4/c14-9-5-11(16-18)10(15-17)4-8(9)7-1-2-12-13(3-7)20-6-19-12/h1-3,8-11H,4-6,14H2 |
| InChIKey | OSYBGWCSXIEDAD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |