C13H17NO2 — CID 53484902
methyl (3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylate (PubChem CID 53484902) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl (3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 53484902 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl (3R,4S)-4-(3-methylphenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C13H17NO2/c1-9-4-3-5-10(6-9)11-7-14-8-12(11)13(15)16-2/h3-6,11-12,14H,7-8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | IRQBRAFXEUYDDN-NEPJUHHUSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |