About methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride
methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride (PubChem CID 154810489) has the molecular formula C7H14ClNO3
and a molecular weight of 195.65 g/mol. Its IUPAC name is methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride.
Analyze methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride?
The IUPAC name of methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride (CID 154810489) is methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride?
The canonical SMILES for methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride is COC(=O)[C@H]1CNCC[C@H]1O.Cl.
What is the InChIKey of methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride?
The InChIKey is FQGPNIORWLTSFB-RIHPBJNCSA-N. The full InChI is InChI=1S/C7H13NO3.ClH/c1-11-7(10)5-4-8-3-2-6(5)9;/h5-6,8-9H,2-4H2,1H3;1H/t5-,6+;/m0./s1.
What are the key properties of methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride?
methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of -0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride is sourced from PubChem (CID 154810489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).