4-hydroxypiperidine-3-carboxylic acid

C6H11NO3 — CID 10261211

IUPAC4-hydroxypiperidine-3-carboxylic acid
SMILESO=C(O)C1CNCCC1O
InChIInChI=1S/C6H11NO3/c8-5-1-2-7-3-4(5)6(9)10/h4-5,7-8H,1-3H2,(H,9,10)
InChIKeyDAMFVOCECLPLSI-UHFFFAOYSA-N
MW145.16 g/mol
LogP-0.96
Rot. Bonds1

About 4-hydroxypiperidine-3-carboxylic acid

4-hydroxypiperidine-3-carboxylic acid (PubChem CID 10261211) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 4-hydroxypiperidine-3-carboxylic acid.

Molecular Properties

Compound Name4-hydroxypiperidine-3-carboxylic acid
PubChem CID10261211
Molecular FormulaC6H11NO3
Molecular Weight145.16 g/mol
Exact Mass145.07
IUPAC Name4-hydroxypiperidine-3-carboxylic acid
SMILESO=C(O)C1CNCCC1O
InChIInChI=1S/C6H11NO3/c8-5-1-2-7-3-4(5)6(9)10/h4-5,7-8H,1-3H2,(H,9,10)
InChIKeyDAMFVOCECLPLSI-UHFFFAOYSA-N
XLogP-0.96
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.16
LogP ≤ 5-0.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-hydroxypiperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-hydroxypiperidine-3-carboxamide
CID 146446982
(3S)-4-methylpiperidine-3-carboxylic acid
CID 67216948
methyl (3S,4R)-4-hydroxypiperidine-3-carboxylate;hydrochloride
CID 154810489
tert-butyl 4-hydroxypiperidine-3-carboxylate
CID 105453621
(3R,4S)-3-methylpiperidine-4-carboxylic acid;hydrochloride
CID 126970561
(4aR,5S,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridine-5-carboxylic acid
CID 178194493
3-cyclobutylpiperidine-4-carboxylic acid
CID 84769140
(3R,4R)-3-propan-2-ylpiperidine-4-carboxylic acid
CID 96740148
3-propan-2-ylpiperidine-4-carboxylic acid
CID 82598426
4-(2-chlorophenyl)piperidine-3-carboxylic acid
CID 82388184
(3S,4R)-3-methylpiperidin-4-ol;hydrochloride
CID 69092530
4-(trifluoromethyl)piperidin-3-ol
CID 82597852

Frequently Asked Questions

What is the IUPAC name of 4-hydroxypiperidine-3-carboxylic acid?
The IUPAC name of 4-hydroxypiperidine-3-carboxylic acid (CID 10261211) is 4-hydroxypiperidine-3-carboxylic acid.
What is the SMILES notation for 4-hydroxypiperidine-3-carboxylic acid?
The canonical SMILES for 4-hydroxypiperidine-3-carboxylic acid is O=C(O)C1CNCCC1O.
What is the InChIKey of 4-hydroxypiperidine-3-carboxylic acid?
The InChIKey is DAMFVOCECLPLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c8-5-1-2-7-3-4(5)6(9)10/h4-5,7-8H,1-3H2,(H,9,10).
What are the key properties of 4-hydroxypiperidine-3-carboxylic acid?
4-hydroxypiperidine-3-carboxylic acid has a molecular weight of 145.16 g/mol, XLogP of -0.96, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypiperidine-3-carboxylic acid is sourced from PubChem (CID 10261211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).