C21H26N4O — CID 11100216
6-methyl-7,9-bis(4-methylphenyl)-1,2,4,8-tetrazaspiro[4.5]decan-3-one (PubChem CID 11100216) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 6-methyl-7,9-bis(4-methylphenyl)-1,2,4,8-tetrazaspiro[4.5]decan-3-one.
| Compound Name | 6-methyl-7,9-bis(4-methylphenyl)-1,2,4,8-tetrazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11100216 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 6-methyl-7,9-bis(4-methylphenyl)-1,2,4,8-tetrazaspiro[4.5]decan-3-one |
| SMILES | Cc1ccc(C2CC3(NNC(=O)N3)C(C)C(c3ccc(C)cc3)N2)cc1 |
| InChI | InChI=1S/C21H26N4O/c1-13-4-8-16(9-5-13)18-12-21(23-20(26)24-25-21)15(3)19(22-18)17-10-6-14(2)7-11-17/h4-11,15,18-19,22,25H,12H2,1-3H3,(H2,23,24,26) |
| InChIKey | FJWXUJLXPKGWOK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |