C20H24N2O — CID 171985956
(NZ)-N-[3-methyl-2,6-bis(4-methylphenyl)piperidin-4-ylidene]hydroxylamine (PubChem CID 171985956) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (NZ)-N-[3-methyl-2,6-bis(4-methylphenyl)piperidin-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[3-methyl-2,6-bis(4-methylphenyl)piperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 171985956 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (NZ)-N-[3-methyl-2,6-bis(4-methylphenyl)piperidin-4-ylidene]hydroxylamine |
| SMILES | Cc1ccc(C2C/C(=N/O)C(C)C(c3ccc(C)cc3)N2)cc1 |
| InChI | InChI=1S/C20H24N2O/c1-13-4-8-16(9-5-13)19-12-18(22-23)15(3)20(21-19)17-10-6-14(2)7-11-17/h4-11,15,19-21,23H,12H2,1-3H3/b22-18- |
| InChIKey | FZNYSOYEZYRJJH-PYCFMQQDSA-N |
| XLogP | 4.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|