C10H10FNO2 — CID 130754471
(3R,4S)-4-(4-fluorophenyl)-3-methoxyazetidin-2-one (PubChem CID 130754471) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is (3R,4S)-4-(4-fluorophenyl)-3-methoxyazetidin-2-one.
| Compound Name | (3R,4S)-4-(4-fluorophenyl)-3-methoxyazetidin-2-one |
|---|---|
| PubChem CID | 130754471 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (3R,4S)-4-(4-fluorophenyl)-3-methoxyazetidin-2-one |
| SMILES | CO[C@H]1C(=O)N[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FNO2/c1-14-9-8(12-10(9)13)6-2-4-7(11)5-3-6/h2-5,8-9H,1H3,(H,12,13)/t8-,9+/m0/s1 |
| InChIKey | AJMXRRTWTUTFAA-DTWKUNHWSA-N |
| XLogP | 1.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |