C12H10N2O3 — CID 122372048
[(2R,3S)-2-(4-cyanophenyl)-4-oxoazetidin-3-yl] acetate (PubChem CID 122372048) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is [(2R,3S)-2-(4-cyanophenyl)-4-oxoazetidin-3-yl] acetate.
| Compound Name | [(2R,3S)-2-(4-cyanophenyl)-4-oxoazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 122372048 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [(2R,3S)-2-(4-cyanophenyl)-4-oxoazetidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)N[C@@H]1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H10N2O3/c1-7(15)17-11-10(14-12(11)16)9-4-2-8(6-13)3-5-9/h2-5,10-11H,1H3,(H,14,16)/t10-,11+/m1/s1 |
| InChIKey | JYMFKDWVBNSKIW-MNOVXSKESA-N |
| XLogP | 0.66 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |