C17H28N2O2Si — CID 20638691
(3R,4S)-4-pyridin-4-yl-3-tri(propan-2-yl)silyloxyazetidin-2-one (PubChem CID 20638691) has the molecular formula C17H28N2O2Si and a molecular weight of 320.51 g/mol. Its IUPAC name is (3R,4S)-4-pyridin-4-yl-3-tri(propan-2-yl)silyloxyazetidin-2-one.
| Compound Name | (3R,4S)-4-pyridin-4-yl-3-tri(propan-2-yl)silyloxyazetidin-2-one |
|---|---|
| PubChem CID | 20638691 |
| Molecular Formula | C17H28N2O2Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (3R,4S)-4-pyridin-4-yl-3-tri(propan-2-yl)silyloxyazetidin-2-one |
| SMILES | CC(C)[Si](O[C@H]1C(=O)N[C@H]1c1ccncc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H28N2O2Si/c1-11(2)22(12(3)4,13(5)6)21-16-15(19-17(16)20)14-7-9-18-10-8-14/h7-13,15-16H,1-6H3,(H,19,20)/t15-,16+/m0/s1 |
| InChIKey | WRXIAPRHOWZGIA-JKSUJKDBSA-N |
| XLogP | 3.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|