About 4-phenylpyrrolidin-2-one;hydrate
4-phenylpyrrolidin-2-one;hydrate (PubChem CID 171699854) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-phenylpyrrolidin-2-one;hydrate.
Molecular Properties
| Compound Name | 4-phenylpyrrolidin-2-one;hydrate |
| PubChem CID | 171699854 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-phenylpyrrolidin-2-one;hydrate |
| SMILES | O.O=C1CC(c2ccccc2)CN1 |
| InChI | InChI=1S/C10H11NO.H2O/c12-10-6-9(7-11-10)8-4-2-1-3-5-8;/h1-5,9H,6-7H2,(H,11,12);1H2 |
| InChIKey | XSSNVSZMWLFPJN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylpyrrolidin-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpyrrolidin-2-one;hydrate?
The IUPAC name of 4-phenylpyrrolidin-2-one;hydrate (CID 171699854) is 4-phenylpyrrolidin-2-one;hydrate.
What is the SMILES notation for 4-phenylpyrrolidin-2-one;hydrate?
The canonical SMILES for 4-phenylpyrrolidin-2-one;hydrate is O.O=C1CC(c2ccccc2)CN1.
What is the InChIKey of 4-phenylpyrrolidin-2-one;hydrate?
The InChIKey is XSSNVSZMWLFPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.H2O/c12-10-6-9(7-11-10)8-4-2-1-3-5-8;/h1-5,9H,6-7H2,(H,11,12);1H2.
What are the key properties of 4-phenylpyrrolidin-2-one;hydrate?
4-phenylpyrrolidin-2-one;hydrate has a molecular weight of 179.22 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpyrrolidin-2-one;hydrate is sourced from PubChem (CID 171699854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).