About 5-phenyldiazinan-3-one
5-phenyldiazinan-3-one (PubChem CID 13486211) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-phenyldiazinan-3-one.
Molecular Properties
| Compound Name | 5-phenyldiazinan-3-one |
| PubChem CID | 13486211 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-phenyldiazinan-3-one |
| SMILES | O=C1CC(c2ccccc2)CNN1 |
| InChI | InChI=1S/C10H12N2O/c13-10-6-9(7-11-12-10)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2,(H,12,13) |
| InChIKey | XLCCLBCTUFXHOG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyldiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyldiazinan-3-one?
The IUPAC name of 5-phenyldiazinan-3-one (CID 13486211) is 5-phenyldiazinan-3-one.
What is the SMILES notation for 5-phenyldiazinan-3-one?
The canonical SMILES for 5-phenyldiazinan-3-one is O=C1CC(c2ccccc2)CNN1.
What is the InChIKey of 5-phenyldiazinan-3-one?
The InChIKey is XLCCLBCTUFXHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c13-10-6-9(7-11-12-10)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2,(H,12,13).
What are the key properties of 5-phenyldiazinan-3-one?
5-phenyldiazinan-3-one has a molecular weight of 176.22 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyldiazinan-3-one is sourced from PubChem (CID 13486211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).