C16H22BrN3O — CID 120850447
3-(3-bromophenyl)-4-(piperidin-4-ylmethyl)piperazin-2-one (PubChem CID 120850447) has the molecular formula C16H22BrN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 3-(3-bromophenyl)-4-(piperidin-4-ylmethyl)piperazin-2-one.
| Compound Name | 3-(3-bromophenyl)-4-(piperidin-4-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 120850447 |
| Molecular Formula | C16H22BrN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-(3-bromophenyl)-4-(piperidin-4-ylmethyl)piperazin-2-one |
| SMILES | O=C1NCCN(CC2CCNCC2)C1c1cccc(Br)c1 |
| InChI | InChI=1S/C16H22BrN3O/c17-14-3-1-2-13(10-14)15-16(21)19-8-9-20(15)11-12-4-6-18-7-5-12/h1-3,10,12,15,18H,4-9,11H2,(H,19,21) |
| InChIKey | HORLEQVYCBWJTB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |