C14H18BrN3O — CID 117030329
6-bromo-4-(piperidin-4-ylmethyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 117030329) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 6-bromo-4-(piperidin-4-ylmethyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 6-bromo-4-(piperidin-4-ylmethyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 117030329 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 6-bromo-4-(piperidin-4-ylmethyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(CC2CCNCC2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C14H18BrN3O/c15-11-1-2-12-13(7-11)18(9-14(19)17-12)8-10-3-5-16-6-4-10/h1-2,7,10,16H,3-6,8-9H2,(H,17,19) |
| InChIKey | GYOSTUMWYKENLI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |