C14H17BrN2O — CID 117006333
6-bromo-4-cyclohexyl-1,3-dihydroquinoxalin-2-one (PubChem CID 117006333) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 6-bromo-4-cyclohexyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 6-bromo-4-cyclohexyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 117006333 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 6-bromo-4-cyclohexyl-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C2CCCCC2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C14H17BrN2O/c15-10-6-7-12-13(8-10)17(9-14(18)16-12)11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H,16,18) |
| InChIKey | RYYUKXAJQSOUII-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |