C15H17BrN2O3 — CID 142508064
cyclohexyl 7-bromo-3-oxo-2,4-dihydroquinoxaline-1-carboxylate (PubChem CID 142508064) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is cyclohexyl 7-bromo-3-oxo-2,4-dihydroquinoxaline-1-carboxylate.
| Compound Name | cyclohexyl 7-bromo-3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 142508064 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | cyclohexyl 7-bromo-3-oxo-2,4-dihydroquinoxaline-1-carboxylate |
| SMILES | O=C1CN(C(=O)OC2CCCCC2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C15H17BrN2O3/c16-10-6-7-12-13(8-10)18(9-14(19)17-12)15(20)21-11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H,17,19) |
| InChIKey | JYUTXXZNGGKSSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |