C13H17BrN2O — CID 117006831
7-bromo-4-pentyl-1,3-dihydroquinoxalin-2-one (PubChem CID 117006831) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is 7-bromo-4-pentyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 7-bromo-4-pentyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 117006831 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 7-bromo-4-pentyl-1,3-dihydroquinoxalin-2-one |
| SMILES | CCCCCN1CC(=O)Nc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H17BrN2O/c1-2-3-4-7-16-9-13(17)15-11-8-10(14)5-6-12(11)16/h5-6,8H,2-4,7,9H2,1H3,(H,15,17) |
| InChIKey | KPAKIGWFWYALQB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|