C11H13IN2O — CID 79295584
7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one (PubChem CID 79295584) has the molecular formula C11H13IN2O and a molecular weight of 316.14 g/mol. Its IUPAC name is 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one.
| Compound Name | 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 79295584 |
| Molecular Formula | C11H13IN2O |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one |
| SMILES | CCCN1CC(=O)Nc2cc(I)ccc21 |
| InChI | InChI=1S/C11H13IN2O/c1-2-5-14-7-11(15)13-9-6-8(12)3-4-10(9)14/h3-4,6H,2,5,7H2,1H3,(H,13,15) |
| InChIKey | DQCZWDDAXSEXJC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|