About 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one
7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one (PubChem CID 79295584) has the molecular formula C11H13IN2O
and a molecular weight of 316.14 g/mol. Its IUPAC name is 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 79295584 |
| Molecular Formula | C11H13IN2O |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one |
| SMILES | CCCN1CC(=O)Nc2cc(I)ccc21 |
| InChI | InChI=1S/C11H13IN2O/c1-2-5-14-7-11(15)13-9-6-8(12)3-4-10(9)14/h3-4,6H,2,5,7H2,1H3,(H,13,15) |
| InChIKey | DQCZWDDAXSEXJC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one (CID 79295584) is 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one is CCCN1CC(=O)Nc2cc(I)ccc21.
What is the InChIKey of 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one?
The InChIKey is DQCZWDDAXSEXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IN2O/c1-2-5-14-7-11(15)13-9-6-8(12)3-4-10(9)14/h3-4,6H,2,5,7H2,1H3,(H,13,15).
What are the key properties of 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one?
7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one has a molecular weight of 316.14 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-4-propyl-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 79295584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).