C15H19BrN2O — CID 100705732
(3R)-3-[4-(3-bromophenyl)piperidin-1-yl]pyrrolidin-2-one (PubChem CID 100705732) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is (3R)-3-[4-(3-bromophenyl)piperidin-1-yl]pyrrolidin-2-one.
| Compound Name | (3R)-3-[4-(3-bromophenyl)piperidin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 100705732 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (3R)-3-[4-(3-bromophenyl)piperidin-1-yl]pyrrolidin-2-one |
| SMILES | O=C1NCC[C@H]1N1CCC(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H19BrN2O/c16-13-3-1-2-12(10-13)11-5-8-18(9-6-11)14-4-7-17-15(14)19/h1-3,10-11,14H,4-9H2,(H,17,19)/t14-/m1/s1 |
| InChIKey | FVVONQGKXVYIHJ-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |