C17H15FN2O3S — CID 71924989
2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 71924989) has the molecular formula C17H15FN2O3S and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 71924989 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCSC2)C(=O)N1Cc1coc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H15FN2O3S/c18-12-3-1-2-11(6-12)15-19-13(9-23-15)8-20-14(21)7-17(16(20)22)4-5-24-10-17/h1-3,6,9H,4-5,7-8,10H2 |
| InChIKey | PVGXVAOWQUIHOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|