About 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole
4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole (PubChem CID 65462999) has the molecular formula C16H20FN3O
and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole |
| PubChem CID | 65462999 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole |
| SMILES | CC1(C)CNCCN1Cc1coc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C16H20FN3O/c1-16(2)11-18-6-7-20(16)9-14-10-21-15(19-14)12-4-3-5-13(17)8-12/h3-5,8,10,18H,6-7,9,11H2,1-2H3 |
| InChIKey | XXXVGMZJVLYWGE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole?
The IUPAC name of 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole (CID 65462999) is 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole.
What is the SMILES notation for 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole?
The canonical SMILES for 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole is CC1(C)CNCCN1Cc1coc(-c2cccc(F)c2)n1.
What is the InChIKey of 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole?
The InChIKey is XXXVGMZJVLYWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3O/c1-16(2)11-18-6-7-20(16)9-14-10-21-15(19-14)12-4-3-5-13(17)8-12/h3-5,8,10,18H,6-7,9,11H2,1-2H3.
What are the key properties of 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole?
4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole has a molecular weight of 289.35 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-dimethylpiperazin-1-yl)methyl]-2-(3-fluorophenyl)-1,3-oxazole is sourced from PubChem (CID 65462999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).