C24H32N3O2+ — CID 9109602
(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl-bis(2-methylpropyl)azanium (PubChem CID 9109602) has the molecular formula C24H32N3O2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl-bis(2-methylpropyl)azanium.
| Compound Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl-bis(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 9109602 |
| Molecular Formula | C24H32N3O2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl-bis(2-methylpropyl)azanium |
| SMILES | CC(C)C[NH+](CC(C)C)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H31N3O2/c1-18(2)15-26(16-19(3)4)17-27-22(28)24(25-23(27)29,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19H,15-17H2,1-4H3,(H,25,29)/p+1 |
| InChIKey | VANPHANPIVOFEA-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|