C23H27ClN4O4 — CID 4882608
3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 4882608) has the molecular formula C23H27ClN4O4 and a molecular weight of 458.95 g/mol. Its IUPAC name is 3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4882608 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(C)NC(=O)N(CN3CCN(c4cccc(Cl)c4)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C23H27ClN4O4/c1-23(16-7-8-19(31-2)20(13-16)32-3)21(29)28(22(30)25-23)15-26-9-11-27(12-10-26)18-6-4-5-17(24)14-18/h4-8,13-14H,9-12,15H2,1-3H3,(H,25,30) |
| InChIKey | YTNPVFVTVKPNCD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|