C16H23BrN2O3S — CID 9289045
1-(2-bromophenyl)sulfonyl-4-[[(2S)-oxan-2-yl]methyl]piperazine (PubChem CID 9289045) has the molecular formula C16H23BrN2O3S and a molecular weight of 403.34 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-4-[[(2S)-oxan-2-yl]methyl]piperazine.
| Compound Name | 1-(2-bromophenyl)sulfonyl-4-[[(2S)-oxan-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 9289045 |
| Molecular Formula | C16H23BrN2O3S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-4-[[(2S)-oxan-2-yl]methyl]piperazine |
| SMILES | O=S(=O)(c1ccccc1Br)N1CCN(C[C@@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C16H23BrN2O3S/c17-15-6-1-2-7-16(15)23(20,21)19-10-8-18(9-11-19)13-14-5-3-4-12-22-14/h1-2,6-7,14H,3-5,8-13H2/t14-/m0/s1 |
| InChIKey | DQDUMDVJYULNAB-AWEZNQCLSA-N |
| XLogP | 2.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |