C16H22F2N2O3S — CID 47034057
1-(3,5-difluorophenyl)sulfonyl-4-(oxolan-2-ylmethyl)-1,4-diazepane (PubChem CID 47034057) has the molecular formula C16H22F2N2O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonyl-4-(oxolan-2-ylmethyl)-1,4-diazepane.
| Compound Name | 1-(3,5-difluorophenyl)sulfonyl-4-(oxolan-2-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 47034057 |
| Molecular Formula | C16H22F2N2O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonyl-4-(oxolan-2-ylmethyl)-1,4-diazepane |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C16H22F2N2O3S/c17-13-9-14(18)11-16(10-13)24(21,22)20-5-2-4-19(6-7-20)12-15-3-1-8-23-15/h9-11,15H,1-8,12H2 |
| InChIKey | MUWDINCANWTOCR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |