C29H38N6O5 — CID 129310240
[4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate (PubChem CID 129310240) has the molecular formula C29H38N6O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is [4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate.
| Compound Name | [4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129310240 |
| Molecular Formula | C29H38N6O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | [4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)ON3C(=O)NC(CNCC4CCN(Cc5ccccc5)CC4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C29H38N6O5/c1-39-25-9-7-24(8-10-25)33-15-17-34(18-16-33)29(38)40-35-27(36)26(31-28(35)37)20-30-19-22-11-13-32(14-12-22)21-23-5-3-2-4-6-23/h2-10,22,26,30H,11-21H2,1H3,(H,31,37) |
| InChIKey | YDNGMDQIHMGEKL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|