C23H29N5O7 — CID 129310286
[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate (PubChem CID 129310286) has the molecular formula C23H29N5O7 and a molecular weight of 487.51 g/mol. Its IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate.
| Compound Name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129310286 |
| Molecular Formula | C23H29N5O7 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2,5-dioxoimidazolidin-1-yl] 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate |
| SMILES | C#CCOc1ccc(N2CCN(C(=O)ON3C(=O)NC(CNC(=O)OC(C)(C)C)C3=O)CC2)cc1 |
| InChI | InChI=1S/C23H29N5O7/c1-5-14-33-17-8-6-16(7-9-17)26-10-12-27(13-11-26)22(32)35-28-19(29)18(25-20(28)30)15-24-21(31)34-23(2,3)4/h1,6-9,18H,10-15H2,2-4H3,(H,24,31)(H,25,30) |
| InChIKey | KKSGEXYHISYMOB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|