C34H37N3O4 — CID 170461896
tert-butyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]piperazine-1-carboxylate (PubChem CID 170461896) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170461896 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | tert-butyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C#CCCNC(=O)OCC3c4ccccc4-c4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C34H37N3O4/c1-34(2,3)41-33(39)37-22-20-36(21-23-37)26-17-15-25(16-18-26)10-8-9-19-35-32(38)40-24-31-29-13-6-4-11-27(29)28-12-5-7-14-30(28)31/h4-7,11-18,31H,9,19-24H2,1-3H3,(H,35,38) |
| InChIKey | LMUGWYFNGDCEDY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|