C30H27NO5 — CID 170461728
methyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]-4-oxobutanoate (PubChem CID 170461728) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 170461728 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | methyl 4-[4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]phenyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ccc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H27NO5/c1-35-29(33)18-17-28(32)22-15-13-21(14-16-22)8-6-7-19-31-30(34)36-20-27-25-11-4-2-9-23(25)24-10-3-5-12-26(24)27/h2-5,9-16,27H,7,17-20H2,1H3,(H,31,34) |
| InChIKey | VEXNGVZZGWANKT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|